About 1-methanidyl-2-phenylindolizine;pentakis(vanadium)
1-methanidyl-2-phenylindolizine;pentakis(vanadium) (PubChem CID 58787377) has the molecular formula C15H12NV5-
and a molecular weight of 460.99 g/mol. Its IUPAC name is 1-methanidyl-2-phenylindolizine;pentakis(vanadium).
Molecular Properties
| Compound Name | 1-methanidyl-2-phenylindolizine;pentakis(vanadium) |
| PubChem CID | 58787377 |
| Molecular Formula | C15H12NV5- |
| Molecular Weight | 460.99 g/mol |
| Exact Mass | 460.82 |
| IUPAC Name | 1-methanidyl-2-phenylindolizine;pentakis(vanadium) |
| SMILES | [CH2-]c1c(-c2ccccc2)cn2ccccc12.[V].[V].[V].[V].[V] |
| InChI | InChI=1S/C15H12N.5V/c1-12-14(13-7-3-2-4-8-13)11-16-10-6-5-9-15(12)16;;;;;/h2-11H,1H2;;;;;/q-1;;;;; |
| InChIKey | VXDDDXHCUMZPTE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 4.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 460.99 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-methanidyl-2-phenylindolizine;pentakis(vanadium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methanidyl-2-phenylindolizine;pentakis(vanadium)?
The IUPAC name of 1-methanidyl-2-phenylindolizine;pentakis(vanadium) (CID 58787377) is 1-methanidyl-2-phenylindolizine;pentakis(vanadium).
What is the SMILES notation for 1-methanidyl-2-phenylindolizine;pentakis(vanadium)?
The canonical SMILES for 1-methanidyl-2-phenylindolizine;pentakis(vanadium) is [CH2-]c1c(-c2ccccc2)cn2ccccc12.[V].[V].[V].[V].[V].
What is the InChIKey of 1-methanidyl-2-phenylindolizine;pentakis(vanadium)?
The InChIKey is VXDDDXHCUMZPTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N.5V/c1-12-14(13-7-3-2-4-8-13)11-16-10-6-5-9-15(12)16;;;;;/h2-11H,1H2;;;;;/q-1;;;;;.
What are the key properties of 1-methanidyl-2-phenylindolizine;pentakis(vanadium)?
1-methanidyl-2-phenylindolizine;pentakis(vanadium) has a molecular weight of 460.99 g/mol, XLogP of 3.78, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methanidyl-2-phenylindolizine;pentakis(vanadium) is sourced from PubChem (CID 58787377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).