C24H29F2N3O3 — CID 169204824
tert-butyl 4-[3-[4-[(E)-1,1-difluorobut-2-enyl]benzoyl]pyrazol-1-yl]piperidine-1-carboxylate (PubChem CID 169204824) has the molecular formula C24H29F2N3O3 and a molecular weight of 445.51 g/mol. Its IUPAC name is tert-butyl 4-[3-[4-[(E)-1,1-difluorobut-2-enyl]benzoyl]pyrazol-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[4-[(E)-1,1-difluorobut-2-enyl]benzoyl]pyrazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 169204824 |
| Molecular Formula | C24H29F2N3O3 |
| Molecular Weight | 445.51 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | tert-butyl 4-[3-[4-[(E)-1,1-difluorobut-2-enyl]benzoyl]pyrazol-1-yl]piperidine-1-carboxylate |
| SMILES | C/C=C/C(F)(F)c1ccc(C(=O)c2ccn(C3CCN(C(=O)OC(C)(C)C)CC3)n2)cc1 |
| InChI | InChI=1S/C24H29F2N3O3/c1-5-13-24(25,26)18-8-6-17(7-9-18)21(30)20-12-16-29(27-20)19-10-14-28(15-11-19)22(31)32-23(2,3)4/h5-9,12-13,16,19H,10-11,14-15H2,1-4H3/b13-5+ |
| InChIKey | SQSOZMTZZWMQDU-WLRTZDKTSA-N |
| XLogP | 5.35 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.51 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|