C21H22F3N3O2 — CID 169205317
1-[4-[C-[1-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]ethenyl]-N-[(Z)-prop-1-enyl]carbonimidoyl]-3,6-dihydro-2H-pyridin-1-yl]-2-fluoroprop-2-en-1-one (PubChem CID 169205317) has the molecular formula C21H22F3N3O2 and a molecular weight of 405.42 g/mol. Its IUPAC name is 1-[4-[C-[1-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]ethenyl]-N-[(Z)-prop-1-enyl]carbonimidoyl]-3,6-dihydro-2H-pyridin-1-yl]-2-fluoroprop-2-en-1-one.
| Compound Name | 1-[4-[C-[1-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]ethenyl]-N-[(Z)-prop-1-enyl]carbonimidoyl]-3,6-dihydro-2H-pyridin-1-yl]-2-fluoroprop-2-en-1-one |
|---|---|
| PubChem CID | 169205317 |
| Molecular Formula | C21H22F3N3O2 |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 1-[4-[C-[1-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]ethenyl]-N-[(Z)-prop-1-enyl]carbonimidoyl]-3,6-dihydro-2H-pyridin-1-yl]-2-fluoroprop-2-en-1-one |
| SMILES | C=C(F)C(=O)N1CC=C(/C(=N/C=C\C)C(=C)Oc2ccc(C(C)(F)F)nc2)CC1 |
| InChI | InChI=1S/C21H22F3N3O2/c1-5-10-25-19(16-8-11-27(12-9-16)20(28)14(2)22)15(3)29-17-6-7-18(26-13-17)21(4,23)24/h5-8,10,13H,2-3,9,11-12H2,1,4H3/b10-5-,25-19+ |
| InChIKey | KNVAJMRKUYKOHL-ADRFGFKZSA-N |
| XLogP | 4.70 |
| TPSA | 54.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|