C42H57N9 — CID 169205632
4-amino-N'-[2-(1-benzylpiperidin-4-yl)ethyl]benzenecarboximidamide;N'-[2-(1-benzylpiperidin-4-yl)ethyl]-4-hydrazinylbenzenecarboximidamide (PubChem CID 169205632) has the molecular formula C42H57N9 and a molecular weight of 687.98 g/mol. Its IUPAC name is 4-amino-N'-[2-(1-benzylpiperidin-4-yl)ethyl]benzenecarboximidamide;N'-[2-(1-benzylpiperidin-4-yl)ethyl]-4-hydrazinylbenzenecarboximidamide.
| Compound Name | 4-amino-N'-[2-(1-benzylpiperidin-4-yl)ethyl]benzenecarboximidamide;N'-[2-(1-benzylpiperidin-4-yl)ethyl]-4-hydrazinylbenzenecarboximidamide |
|---|---|
| PubChem CID | 169205632 |
| Molecular Formula | C42H57N9 |
| Molecular Weight | 687.98 g/mol |
| Exact Mass | 687.47 |
| IUPAC Name | 4-amino-N'-[2-(1-benzylpiperidin-4-yl)ethyl]benzenecarboximidamide;N'-[2-(1-benzylpiperidin-4-yl)ethyl]-4-hydrazinylbenzenecarboximidamide |
| SMILES | N/C(=N\CCC1CCN(Cc2ccccc2)CC1)c1ccc(N)cc1.NNc1ccc(/C(N)=N/CCC2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C21H29N5.C21H28N4/c22-21(19-6-8-20(25-23)9-7-19)24-13-10-17-11-14-26(15-12-17)16-18-4-2-1-3-5-18;22-20-8-6-19(7-9-20)21(23)24-13-10-17-11-14-25(15-12-17)16-18-4-2-1-3-5-18/h1-9,17,25H,10-16,23H2,(H2,22,24);1-9,17H,10-16,22H2,(H2,23,24) |
| InChIKey | SCXIOSUHIXFZOM-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 147.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.98 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|