C20H15F3N2O3 — CID 169207141
cyclopropyl 4-amino-2-oxo-1-phenyl-7-(trifluoromethyl)quinoline-3-carboxylate (PubChem CID 169207141) has the molecular formula C20H15F3N2O3 and a molecular weight of 388.35 g/mol. Its IUPAC name is cyclopropyl 4-amino-2-oxo-1-phenyl-7-(trifluoromethyl)quinoline-3-carboxylate.
| Compound Name | cyclopropyl 4-amino-2-oxo-1-phenyl-7-(trifluoromethyl)quinoline-3-carboxylate |
|---|---|
| PubChem CID | 169207141 |
| Molecular Formula | C20H15F3N2O3 |
| Molecular Weight | 388.35 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | cyclopropyl 4-amino-2-oxo-1-phenyl-7-(trifluoromethyl)quinoline-3-carboxylate |
| SMILES | Nc1c(C(=O)OC2CC2)c(=O)n(-c2ccccc2)c2cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C20H15F3N2O3/c21-20(22,23)11-6-9-14-15(10-11)25(12-4-2-1-3-5-12)18(26)16(17(14)24)19(27)28-13-7-8-13/h1-6,9-10,13H,7-8,24H2 |
| InChIKey | WHNUYQLGSPPZGB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.35 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |