C20H14F3N3O3 — CID 169207061
methyl 4-amino-1-(1H-indol-4-yl)-2-oxo-7-(trifluoromethyl)quinoline-3-carboxylate (PubChem CID 169207061) has the molecular formula C20H14F3N3O3 and a molecular weight of 401.34 g/mol. Its IUPAC name is methyl 4-amino-1-(1H-indol-4-yl)-2-oxo-7-(trifluoromethyl)quinoline-3-carboxylate.
| Compound Name | methyl 4-amino-1-(1H-indol-4-yl)-2-oxo-7-(trifluoromethyl)quinoline-3-carboxylate |
|---|---|
| PubChem CID | 169207061 |
| Molecular Formula | C20H14F3N3O3 |
| Molecular Weight | 401.34 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | methyl 4-amino-1-(1H-indol-4-yl)-2-oxo-7-(trifluoromethyl)quinoline-3-carboxylate |
| SMILES | COC(=O)c1c(N)c2ccc(C(F)(F)F)cc2n(-c2cccc3[nH]ccc23)c1=O |
| InChI | InChI=1S/C20H14F3N3O3/c1-29-19(28)16-17(24)12-6-5-10(20(21,22)23)9-15(12)26(18(16)27)14-4-2-3-13-11(14)7-8-25-13/h2-9,25H,24H2,1H3 |
| InChIKey | UFXLGIKAPKBBHC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 90.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.34 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |