C34H44FN3O3S — CID 169207464
methyl 2-[7-[2-[4-(6-fluoro-1-benzothiophen-4-yl)piperazin-1-yl]ethyl]-2-oxo-3,4-dihydroquinolin-1-yl]decanoate (PubChem CID 169207464) has the molecular formula C34H44FN3O3S and a molecular weight of 593.81 g/mol. Its IUPAC name is methyl 2-[7-[2-[4-(6-fluoro-1-benzothiophen-4-yl)piperazin-1-yl]ethyl]-2-oxo-3,4-dihydroquinolin-1-yl]decanoate.
| Compound Name | methyl 2-[7-[2-[4-(6-fluoro-1-benzothiophen-4-yl)piperazin-1-yl]ethyl]-2-oxo-3,4-dihydroquinolin-1-yl]decanoate |
|---|---|
| PubChem CID | 169207464 |
| Molecular Formula | C34H44FN3O3S |
| Molecular Weight | 593.81 g/mol |
| Exact Mass | 593.31 |
| IUPAC Name | methyl 2-[7-[2-[4-(6-fluoro-1-benzothiophen-4-yl)piperazin-1-yl]ethyl]-2-oxo-3,4-dihydroquinolin-1-yl]decanoate |
| SMILES | CCCCCCCCC(C(=O)OC)N1C(=O)CCc2ccc(CCN3CCN(c4cc(F)cc5sccc45)CC3)cc21 |
| InChI | InChI=1S/C34H44FN3O3S/c1-3-4-5-6-7-8-9-29(34(40)41-2)38-30-22-25(10-11-26(30)12-13-33(38)39)14-16-36-17-19-37(20-18-36)31-23-27(35)24-32-28(31)15-21-42-32/h10-11,15,21-24,29H,3-9,12-14,16-20H2,1-2H3 |
| InChIKey | FQXZFHBXXQAGLW-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.81 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|