C31H38FN3O3S — CID 169207506
methyl 2-[7-[2-[4-(6-fluoro-1-benzothiophen-4-yl)piperazin-1-yl]ethyl]-2-oxo-3,4-dihydroquinolin-1-yl]heptanoate (PubChem CID 169207506) has the molecular formula C31H38FN3O3S and a molecular weight of 551.73 g/mol. Its IUPAC name is methyl 2-[7-[2-[4-(6-fluoro-1-benzothiophen-4-yl)piperazin-1-yl]ethyl]-2-oxo-3,4-dihydroquinolin-1-yl]heptanoate.
| Compound Name | methyl 2-[7-[2-[4-(6-fluoro-1-benzothiophen-4-yl)piperazin-1-yl]ethyl]-2-oxo-3,4-dihydroquinolin-1-yl]heptanoate |
|---|---|
| PubChem CID | 169207506 |
| Molecular Formula | C31H38FN3O3S |
| Molecular Weight | 551.73 g/mol |
| Exact Mass | 551.26 |
| IUPAC Name | methyl 2-[7-[2-[4-(6-fluoro-1-benzothiophen-4-yl)piperazin-1-yl]ethyl]-2-oxo-3,4-dihydroquinolin-1-yl]heptanoate |
| SMILES | CCCCCC(C(=O)OC)N1C(=O)CCc2ccc(CCN3CCN(c4cc(F)cc5sccc45)CC3)cc21 |
| InChI | InChI=1S/C31H38FN3O3S/c1-3-4-5-6-26(31(37)38-2)35-27-19-22(7-8-23(27)9-10-30(35)36)11-13-33-14-16-34(17-15-33)28-20-24(32)21-29-25(28)12-18-39-29/h7-8,12,18-21,26H,3-6,9-11,13-17H2,1-2H3 |
| InChIKey | KSFCVICJKYRLMO-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.73 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|