C14H15ClN2O5 — CID 16921016
ethyl 2-[[3-(3-chlorophenyl)-2-oxo-1,3-oxazolidin-5-yl]methylamino]-2-oxoacetate (PubChem CID 16921016) has the molecular formula C14H15ClN2O5 and a molecular weight of 326.74 g/mol. Its IUPAC name is ethyl 2-[[3-(3-chlorophenyl)-2-oxo-1,3-oxazolidin-5-yl]methylamino]-2-oxoacetate.
| Compound Name | ethyl 2-[[3-(3-chlorophenyl)-2-oxo-1,3-oxazolidin-5-yl]methylamino]-2-oxoacetate |
|---|---|
| PubChem CID | 16921016 |
| Molecular Formula | C14H15ClN2O5 |
| Molecular Weight | 326.74 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | ethyl 2-[[3-(3-chlorophenyl)-2-oxo-1,3-oxazolidin-5-yl]methylamino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)NCC1CN(c2cccc(Cl)c2)C(=O)O1 |
| InChI | InChI=1S/C14H15ClN2O5/c1-2-21-13(19)12(18)16-7-11-8-17(14(20)22-11)10-5-3-4-9(15)6-10/h3-6,11H,2,7-8H2,1H3,(H,16,18) |
| InChIKey | FAGZADICHZKZNK-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.74 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|