C15H18N2O6 — CID 16921319
ethyl 2-[[3-(4-methoxyphenyl)-2-oxo-1,3-oxazolidin-5-yl]methylamino]-2-oxoacetate (PubChem CID 16921319) has the molecular formula C15H18N2O6 and a molecular weight of 322.32 g/mol. Its IUPAC name is ethyl 2-[[3-(4-methoxyphenyl)-2-oxo-1,3-oxazolidin-5-yl]methylamino]-2-oxoacetate.
| Compound Name | ethyl 2-[[3-(4-methoxyphenyl)-2-oxo-1,3-oxazolidin-5-yl]methylamino]-2-oxoacetate |
|---|---|
| PubChem CID | 16921319 |
| Molecular Formula | C15H18N2O6 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | ethyl 2-[[3-(4-methoxyphenyl)-2-oxo-1,3-oxazolidin-5-yl]methylamino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)NCC1CN(c2ccc(OC)cc2)C(=O)O1 |
| InChI | InChI=1S/C15H18N2O6/c1-3-22-14(19)13(18)16-8-12-9-17(15(20)23-12)10-4-6-11(21-2)7-5-10/h4-7,12H,3,8-9H2,1-2H3,(H,16,18) |
| InChIKey | BRQTYNRLRQPLDY-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|