C23H16F5NO3 — CID 169210392
2-amino-7-[2-(2,3,4,5,6-pentafluorophenyl)phenoxy]-3,4-dihydro-1H-naphthalene-2-carboxylic acid (PubChem CID 169210392) has the molecular formula C23H16F5NO3 and a molecular weight of 449.38 g/mol. Its IUPAC name is 2-amino-7-[2-(2,3,4,5,6-pentafluorophenyl)phenoxy]-3,4-dihydro-1H-naphthalene-2-carboxylic acid.
| Compound Name | 2-amino-7-[2-(2,3,4,5,6-pentafluorophenyl)phenoxy]-3,4-dihydro-1H-naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 169210392 |
| Molecular Formula | C23H16F5NO3 |
| Molecular Weight | 449.38 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | 2-amino-7-[2-(2,3,4,5,6-pentafluorophenyl)phenoxy]-3,4-dihydro-1H-naphthalene-2-carboxylic acid |
| SMILES | NC1(C(=O)O)CCc2ccc(Oc3ccccc3-c3c(F)c(F)c(F)c(F)c3F)cc2C1 |
| InChI | InChI=1S/C23H16F5NO3/c24-17-16(18(25)20(27)21(28)19(17)26)14-3-1-2-4-15(14)32-13-6-5-11-7-8-23(29,22(30)31)10-12(11)9-13/h1-6,9H,7-8,10,29H2,(H,30,31) |
| InChIKey | BYGLBSDXVOJNNA-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.38 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|