C25H22ClNO3 — CID 174107867
2-amino-7-anthracen-2-yloxy-3,4-dihydro-1H-naphthalene-2-carboxylic acid;hydrochloride (PubChem CID 174107867) has the molecular formula C25H22ClNO3 and a molecular weight of 419.91 g/mol. Its IUPAC name is 2-amino-7-anthracen-2-yloxy-3,4-dihydro-1H-naphthalene-2-carboxylic acid;hydrochloride.
| Compound Name | 2-amino-7-anthracen-2-yloxy-3,4-dihydro-1H-naphthalene-2-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 174107867 |
| Molecular Formula | C25H22ClNO3 |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 2-amino-7-anthracen-2-yloxy-3,4-dihydro-1H-naphthalene-2-carboxylic acid;hydrochloride |
| SMILES | Cl.NC1(C(=O)O)CCc2ccc(Oc3ccc4cc5ccccc5cc4c3)cc2C1 |
| InChI | InChI=1S/C25H21NO3.ClH/c26-25(24(27)28)10-9-16-5-7-23(14-21(16)15-25)29-22-8-6-19-11-17-3-1-2-4-18(17)12-20(19)13-22;/h1-8,11-14H,9-10,15,26H2,(H,27,28);1H |
| InChIKey | PWZYWGNPDIFMEC-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|