C33H34N4O — CID 169212418
4-[(E)-2-[4-[(2-cyclononyl-3H-imidazo[4,5-c]quinolin-4-yl)amino]phenyl]ethenyl]phenol (PubChem CID 169212418) has the molecular formula C33H34N4O and a molecular weight of 502.66 g/mol. Its IUPAC name is 4-[(E)-2-[4-[(2-cyclononyl-3H-imidazo[4,5-c]quinolin-4-yl)amino]phenyl]ethenyl]phenol.
| Compound Name | 4-[(E)-2-[4-[(2-cyclononyl-3H-imidazo[4,5-c]quinolin-4-yl)amino]phenyl]ethenyl]phenol |
|---|---|
| PubChem CID | 169212418 |
| Molecular Formula | C33H34N4O |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.27 |
| IUPAC Name | 4-[(E)-2-[4-[(2-cyclononyl-3H-imidazo[4,5-c]quinolin-4-yl)amino]phenyl]ethenyl]phenol |
| SMILES | Oc1ccc(/C=C/c2ccc(Nc3nc4ccccc4c4nc(C5CCCCCCCC5)[nH]c34)cc2)cc1 |
| InChI | InChI=1S/C33H34N4O/c38-27-21-17-24(18-22-27)14-13-23-15-19-26(20-16-23)34-33-31-30(28-11-7-8-12-29(28)35-33)36-32(37-31)25-9-5-3-1-2-4-6-10-25/h7-8,11-22,25,38H,1-6,9-10H2,(H,34,35)(H,36,37)/b14-13+ |
| InChIKey | WXZTUPMNZFYDAK-BUHFOSPRSA-N |
| XLogP | 8.95 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|