C22H24FN3O3 — CID 169212898
6-[[(2S,3S,4S)-3-ethyl-4-fluoro-5-oxopyrrolidin-2-yl]methoxy]-4-propan-2-yl-2H-pyrido[3,4-g]isoquinolin-1-one (PubChem CID 169212898) has the molecular formula C22H24FN3O3 and a molecular weight of 397.45 g/mol. Its IUPAC name is 6-[[(2S,3S,4S)-3-ethyl-4-fluoro-5-oxopyrrolidin-2-yl]methoxy]-4-propan-2-yl-2H-pyrido[3,4-g]isoquinolin-1-one.
| Compound Name | 6-[[(2S,3S,4S)-3-ethyl-4-fluoro-5-oxopyrrolidin-2-yl]methoxy]-4-propan-2-yl-2H-pyrido[3,4-g]isoquinolin-1-one |
|---|---|
| PubChem CID | 169212898 |
| Molecular Formula | C22H24FN3O3 |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 6-[[(2S,3S,4S)-3-ethyl-4-fluoro-5-oxopyrrolidin-2-yl]methoxy]-4-propan-2-yl-2H-pyrido[3,4-g]isoquinolin-1-one |
| SMILES | CC[C@@H]1[C@H](F)C(=O)N[C@@H]1COc1nccc2cc3c(=O)[nH]cc(C(C)C)c3cc12 |
| InChI | InChI=1S/C22H24FN3O3/c1-4-13-18(26-21(28)19(13)23)10-29-22-14-8-15-16(7-12(14)5-6-24-22)20(27)25-9-17(15)11(2)3/h5-9,11,13,18-19H,4,10H2,1-3H3,(H,25,27)(H,26,28)/t13-,18+,19-/m0/s1 |
| InChIKey | ZUCBUDQHWFXTRP-BKTGTZMESA-N |
| XLogP | 3.44 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|