C23H24O6 — CID 169212973
[(2R,3S)-2-ethyl-3-(4-methylbenzoyl)oxy-5-oxooxolan-2-yl]methyl 4-methylbenzoate (PubChem CID 169212973) has the molecular formula C23H24O6 and a molecular weight of 396.44 g/mol. Its IUPAC name is [(2R,3S)-2-ethyl-3-(4-methylbenzoyl)oxy-5-oxooxolan-2-yl]methyl 4-methylbenzoate.
| Compound Name | [(2R,3S)-2-ethyl-3-(4-methylbenzoyl)oxy-5-oxooxolan-2-yl]methyl 4-methylbenzoate |
|---|---|
| PubChem CID | 169212973 |
| Molecular Formula | C23H24O6 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | [(2R,3S)-2-ethyl-3-(4-methylbenzoyl)oxy-5-oxooxolan-2-yl]methyl 4-methylbenzoate |
| SMILES | CC[C@]1(COC(=O)c2ccc(C)cc2)OC(=O)C[C@@H]1OC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H24O6/c1-4-23(14-27-21(25)17-9-5-15(2)6-10-17)19(13-20(24)29-23)28-22(26)18-11-7-16(3)8-12-18/h5-12,19H,4,13-14H2,1-3H3/t19-,23+/m0/s1 |
| InChIKey | AMKIRQDXVWIBBQ-WMZHIEFXSA-N |
| XLogP | 3.78 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|