C13H20F3N3O3 — CID 169213476
tert-butyl N-[1-(2-hydroxy-2-methylpropyl)-5-(trifluoromethyl)pyrazol-4-yl]carbamate (PubChem CID 169213476) has the molecular formula C13H20F3N3O3 and a molecular weight of 323.32 g/mol. Its IUPAC name is tert-butyl N-[1-(2-hydroxy-2-methylpropyl)-5-(trifluoromethyl)pyrazol-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-(2-hydroxy-2-methylpropyl)-5-(trifluoromethyl)pyrazol-4-yl]carbamate |
|---|---|
| PubChem CID | 169213476 |
| Molecular Formula | C13H20F3N3O3 |
| Molecular Weight | 323.32 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | tert-butyl N-[1-(2-hydroxy-2-methylpropyl)-5-(trifluoromethyl)pyrazol-4-yl]carbamate |
| SMILES | CC(C)(O)Cn1ncc(NC(=O)OC(C)(C)C)c1C(F)(F)F |
| InChI | InChI=1S/C13H20F3N3O3/c1-11(2,3)22-10(20)18-8-6-17-19(7-12(4,5)21)9(8)13(14,15)16/h6,21H,7H2,1-5H3,(H,18,20) |
| InChIKey | JMYNWTOZDHXONK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |