C24H35N3O4 — CID 169214641
ethyl (3S)-1-[5-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hex-1-ynyl]-3-pyridinyl]piperidine-3-carboxylate (PubChem CID 169214641) has the molecular formula C24H35N3O4 and a molecular weight of 429.56 g/mol. Its IUPAC name is ethyl (3S)-1-[5-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hex-1-ynyl]-3-pyridinyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-[5-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hex-1-ynyl]-3-pyridinyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 169214641 |
| Molecular Formula | C24H35N3O4 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.26 |
| IUPAC Name | ethyl (3S)-1-[5-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hex-1-ynyl]-3-pyridinyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCN(c2cncc(C#CCCCCNC(=O)OC(C)(C)C)c2)C1 |
| InChI | InChI=1S/C24H35N3O4/c1-5-30-22(28)20-12-10-14-27(18-20)21-15-19(16-25-17-21)11-8-6-7-9-13-26-23(29)31-24(2,3)4/h15-17,20H,5-7,9-10,12-14,18H2,1-4H3,(H,26,29)/t20-/m0/s1 |
| InChIKey | XMUWSYSKRQPLGD-FQEVSTJZSA-N |
| XLogP | 3.91 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|