C26H37N5O4 — CID 169214693
ethyl 2-[5-[[(3S)-1-[5-(6-aminohexyl)-3-pyridinyl]piperidine-3-carbonyl]amino]-2-oxo-1-pyridinyl]acetate (PubChem CID 169214693) has the molecular formula C26H37N5O4 and a molecular weight of 483.61 g/mol. Its IUPAC name is ethyl 2-[5-[[(3S)-1-[5-(6-aminohexyl)-3-pyridinyl]piperidine-3-carbonyl]amino]-2-oxo-1-pyridinyl]acetate.
| Compound Name | ethyl 2-[5-[[(3S)-1-[5-(6-aminohexyl)-3-pyridinyl]piperidine-3-carbonyl]amino]-2-oxo-1-pyridinyl]acetate |
|---|---|
| PubChem CID | 169214693 |
| Molecular Formula | C26H37N5O4 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.28 |
| IUPAC Name | ethyl 2-[5-[[(3S)-1-[5-(6-aminohexyl)-3-pyridinyl]piperidine-3-carbonyl]amino]-2-oxo-1-pyridinyl]acetate |
| SMILES | CCOC(=O)Cn1cc(NC(=O)[C@H]2CCCN(c3cncc(CCCCCCN)c3)C2)ccc1=O |
| InChI | InChI=1S/C26H37N5O4/c1-2-35-25(33)19-31-18-22(10-11-24(31)32)29-26(34)21-9-7-13-30(17-21)23-14-20(15-28-16-23)8-5-3-4-6-12-27/h10-11,14-16,18,21H,2-9,12-13,17,19,27H2,1H3,(H,29,34)/t21-/m0/s1 |
| InChIKey | CVXLFNCCKJJNFU-NRFANRHFSA-N |
| XLogP | 2.72 |
| TPSA | 119.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|