C20H23N5O6 — CID 169214974
ethyl 2-[5-[[(3S)-1-(5-nitro-3-pyridinyl)piperidine-3-carbonyl]amino]-2-oxo-1-pyridinyl]acetate (PubChem CID 169214974) has the molecular formula C20H23N5O6 and a molecular weight of 429.43 g/mol. Its IUPAC name is ethyl 2-[5-[[(3S)-1-(5-nitro-3-pyridinyl)piperidine-3-carbonyl]amino]-2-oxo-1-pyridinyl]acetate.
| Compound Name | ethyl 2-[5-[[(3S)-1-(5-nitro-3-pyridinyl)piperidine-3-carbonyl]amino]-2-oxo-1-pyridinyl]acetate |
|---|---|
| PubChem CID | 169214974 |
| Molecular Formula | C20H23N5O6 |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | ethyl 2-[5-[[(3S)-1-(5-nitro-3-pyridinyl)piperidine-3-carbonyl]amino]-2-oxo-1-pyridinyl]acetate |
| SMILES | CCOC(=O)Cn1cc(NC(=O)[C@H]2CCCN(c3cncc([N+](=O)[O-])c3)C2)ccc1=O |
| InChI | InChI=1S/C20H23N5O6/c1-2-31-19(27)13-24-12-15(5-6-18(24)26)22-20(28)14-4-3-7-23(11-14)16-8-17(25(29)30)10-21-9-16/h5-6,8-10,12,14H,2-4,7,11,13H2,1H3,(H,22,28)/t14-/m0/s1 |
| InChIKey | FZKILHSZWQGJEY-AWEZNQCLSA-N |
| XLogP | 1.57 |
| TPSA | 136.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|