C23H24ClFN4O — CID 169215479
3-chloro-5-fluoro-N-[4-[(2-phenyl-1H-imidazol-5-yl)methylamino]cyclohexyl]benzamide (PubChem CID 169215479) has the molecular formula C23H24ClFN4O and a molecular weight of 426.92 g/mol. Its IUPAC name is 3-chloro-5-fluoro-N-[4-[(2-phenyl-1H-imidazol-5-yl)methylamino]cyclohexyl]benzamide.
| Compound Name | 3-chloro-5-fluoro-N-[4-[(2-phenyl-1H-imidazol-5-yl)methylamino]cyclohexyl]benzamide |
|---|---|
| PubChem CID | 169215479 |
| Molecular Formula | C23H24ClFN4O |
| Molecular Weight | 426.92 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 3-chloro-5-fluoro-N-[4-[(2-phenyl-1H-imidazol-5-yl)methylamino]cyclohexyl]benzamide |
| SMILES | O=C(NC1CCC(NCc2cnc(-c3ccccc3)[nH]2)CC1)c1cc(F)cc(Cl)c1 |
| InChI | InChI=1S/C23H24ClFN4O/c24-17-10-16(11-18(25)12-17)23(30)29-20-8-6-19(7-9-20)26-13-21-14-27-22(28-21)15-4-2-1-3-5-15/h1-5,10-12,14,19-20,26H,6-9,13H2,(H,27,28)(H,29,30) |
| InChIKey | BRTUHCWEAWNFSM-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.92 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |