C21H21ClFN3O — CID 169215528
3-chloro-5-fluoro-N-[(1R,3S)-3-(1H-indol-2-ylmethylamino)cyclopentyl]benzamide (PubChem CID 169215528) has the molecular formula C21H21ClFN3O and a molecular weight of 385.87 g/mol. Its IUPAC name is 3-chloro-5-fluoro-N-[(1R,3S)-3-(1H-indol-2-ylmethylamino)cyclopentyl]benzamide.
| Compound Name | 3-chloro-5-fluoro-N-[(1R,3S)-3-(1H-indol-2-ylmethylamino)cyclopentyl]benzamide |
|---|---|
| PubChem CID | 169215528 |
| Molecular Formula | C21H21ClFN3O |
| Molecular Weight | 385.87 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 3-chloro-5-fluoro-N-[(1R,3S)-3-(1H-indol-2-ylmethylamino)cyclopentyl]benzamide |
| SMILES | O=C(N[C@@H]1CC[C@H](NCc2cc3ccccc3[nH]2)C1)c1cc(F)cc(Cl)c1 |
| InChI | InChI=1S/C21H21ClFN3O/c22-15-7-14(8-16(23)10-15)21(27)26-18-6-5-17(11-18)24-12-19-9-13-3-1-2-4-20(13)25-19/h1-4,7-10,17-18,24-25H,5-6,11-12H2,(H,26,27)/t17-,18+/m0/s1 |
| InChIKey | WVCZBDWOERNEOC-ZWKOTPCHSA-N |
| XLogP | 4.40 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.87 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |