C17H24ClFN2O — CID 169215470
3-chloro-N-[3-(2,2-dimethylbutylamino)cyclobutyl]-5-fluorobenzamide (PubChem CID 169215470) has the molecular formula C17H24ClFN2O and a molecular weight of 326.84 g/mol. Its IUPAC name is 3-chloro-N-[3-(2,2-dimethylbutylamino)cyclobutyl]-5-fluorobenzamide.
| Compound Name | 3-chloro-N-[3-(2,2-dimethylbutylamino)cyclobutyl]-5-fluorobenzamide |
|---|---|
| PubChem CID | 169215470 |
| Molecular Formula | C17H24ClFN2O |
| Molecular Weight | 326.84 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 3-chloro-N-[3-(2,2-dimethylbutylamino)cyclobutyl]-5-fluorobenzamide |
| SMILES | CCC(C)(C)CNC1CC(NC(=O)c2cc(F)cc(Cl)c2)C1 |
| InChI | InChI=1S/C17H24ClFN2O/c1-4-17(2,3)10-20-14-8-15(9-14)21-16(22)11-5-12(18)7-13(19)6-11/h5-7,14-15,20H,4,8-10H2,1-3H3,(H,21,22) |
| InChIKey | DSEIYFQLKDHIKM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.84 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |