C19H26ClFN2O — CID 169215368
3-chloro-N-[3-(2-cyclopentylethylamino)-1-methylcyclobutyl]-5-fluorobenzamide (PubChem CID 169215368) has the molecular formula C19H26ClFN2O and a molecular weight of 352.88 g/mol. Its IUPAC name is 3-chloro-N-[3-(2-cyclopentylethylamino)-1-methylcyclobutyl]-5-fluorobenzamide.
| Compound Name | 3-chloro-N-[3-(2-cyclopentylethylamino)-1-methylcyclobutyl]-5-fluorobenzamide |
|---|---|
| PubChem CID | 169215368 |
| Molecular Formula | C19H26ClFN2O |
| Molecular Weight | 352.88 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 3-chloro-N-[3-(2-cyclopentylethylamino)-1-methylcyclobutyl]-5-fluorobenzamide |
| SMILES | CC1(NC(=O)c2cc(F)cc(Cl)c2)CC(NCCC2CCCC2)C1 |
| InChI | InChI=1S/C19H26ClFN2O/c1-19(23-18(24)14-8-15(20)10-16(21)9-14)11-17(12-19)22-7-6-13-4-2-3-5-13/h8-10,13,17,22H,2-7,11-12H2,1H3,(H,23,24) |
| InChIKey | LHDKDEBRGBXVRB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.88 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |