About 1-chloro-3-fluorobenzene;1-[4-(2-cyclohexylethylamino)piperidin-1-yl]ethanone
1-chloro-3-fluorobenzene;1-[4-(2-cyclohexylethylamino)piperidin-1-yl]ethanone (PubChem CID 153338437) has the molecular formula C21H32ClFN2O
and a molecular weight of 382.95 g/mol. Its IUPAC name is 1-chloro-3-fluorobenzene;1-[4-(2-cyclohexylethylamino)piperidin-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-chloro-3-fluorobenzene;1-[4-(2-cyclohexylethylamino)piperidin-1-yl]ethanone |
| PubChem CID | 153338437 |
| Molecular Formula | C21H32ClFN2O |
| Molecular Weight | 382.95 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | 1-chloro-3-fluorobenzene;1-[4-(2-cyclohexylethylamino)piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(NCCC2CCCCC2)CC1.Fc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H28N2O.C6H4ClF/c1-13(18)17-11-8-15(9-12-17)16-10-7-14-5-3-2-4-6-14;7-5-2-1-3-6(8)4-5/h14-16H,2-12H2,1H3;1-4H |
| InChIKey | IHBUDLHPDZKNID-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.95 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-chloro-3-fluorobenzene;1-[4-(2-cyclohexylethylamino)piperidin-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-3-fluorobenzene;1-[4-(2-cyclohexylethylamino)piperidin-1-yl]ethanone?
The IUPAC name of 1-chloro-3-fluorobenzene;1-[4-(2-cyclohexylethylamino)piperidin-1-yl]ethanone (CID 153338437) is 1-chloro-3-fluorobenzene;1-[4-(2-cyclohexylethylamino)piperidin-1-yl]ethanone.
What is the SMILES notation for 1-chloro-3-fluorobenzene;1-[4-(2-cyclohexylethylamino)piperidin-1-yl]ethanone?
The canonical SMILES for 1-chloro-3-fluorobenzene;1-[4-(2-cyclohexylethylamino)piperidin-1-yl]ethanone is CC(=O)N1CCC(NCCC2CCCCC2)CC1.Fc1cccc(Cl)c1.
What is the InChIKey of 1-chloro-3-fluorobenzene;1-[4-(2-cyclohexylethylamino)piperidin-1-yl]ethanone?
The InChIKey is IHBUDLHPDZKNID-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N2O.C6H4ClF/c1-13(18)17-11-8-15(9-12-17)16-10-7-14-5-3-2-4-6-14;7-5-2-1-3-6(8)4-5/h14-16H,2-12H2,1H3;1-4H.
What are the key properties of 1-chloro-3-fluorobenzene;1-[4-(2-cyclohexylethylamino)piperidin-1-yl]ethanone?
1-chloro-3-fluorobenzene;1-[4-(2-cyclohexylethylamino)piperidin-1-yl]ethanone has a molecular weight of 382.95 g/mol, XLogP of 5.04, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-3-fluorobenzene;1-[4-(2-cyclohexylethylamino)piperidin-1-yl]ethanone is sourced from PubChem (CID 153338437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).