C23H24ClF3N5O- — CID 169218365
N-[(3S)-3-[[6-chloro-2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]-2-propylpyrazole-3-carboximidate (PubChem CID 169218365) has the molecular formula C23H24ClF3N5O- and a molecular weight of 478.93 g/mol. Its IUPAC name is N-[(3S)-3-[[6-chloro-2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]-2-propylpyrazole-3-carboximidate.
| Compound Name | N-[(3S)-3-[[6-chloro-2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]-2-propylpyrazole-3-carboximidate |
|---|---|
| PubChem CID | 169218365 |
| Molecular Formula | C23H24ClF3N5O- |
| Molecular Weight | 478.93 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | N-[(3S)-3-[[6-chloro-2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]-2-propylpyrazole-3-carboximidate |
| SMILES | CCCn1nccc1/C([O-])=N/C1CCC[C@H](Nc2cc(C(F)(F)F)nc3ccc(Cl)cc23)C1 |
| InChI | InChI=1S/C23H25ClF3N5O/c1-2-10-32-20(8-9-28-32)22(33)30-16-5-3-4-15(12-16)29-19-13-21(23(25,26)27)31-18-7-6-14(24)11-17(18)19/h6-9,11,13,15-16H,2-5,10,12H2,1H3,(H,29,31)(H,30,33)/p-1/t15-,16?/m0/s1 |
| InChIKey | YQZJNEKUTZCTSI-VYRBHSGPSA-M |
| XLogP | 5.04 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.93 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|