C25H29ClF3N3O2 — CID 169218499
6-chloro-N-methyl-2-(trifluoromethyl)quinolin-4-amine;cyclohexane;4-methoxybenzamide (PubChem CID 169218499) has the molecular formula C25H29ClF3N3O2 and a molecular weight of 495.97 g/mol. Its IUPAC name is 6-chloro-N-methyl-2-(trifluoromethyl)quinolin-4-amine;cyclohexane;4-methoxybenzamide.
| Compound Name | 6-chloro-N-methyl-2-(trifluoromethyl)quinolin-4-amine;cyclohexane;4-methoxybenzamide |
|---|---|
| PubChem CID | 169218499 |
| Molecular Formula | C25H29ClF3N3O2 |
| Molecular Weight | 495.97 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | 6-chloro-N-methyl-2-(trifluoromethyl)quinolin-4-amine;cyclohexane;4-methoxybenzamide |
| SMILES | C1CCCCC1.CNc1cc(C(F)(F)F)nc2ccc(Cl)cc12.COc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C11H8ClF3N2.C8H9NO2.C6H12/c1-16-9-5-10(11(13,14)15)17-8-3-2-6(12)4-7(8)9;1-11-7-4-2-6(3-5-7)8(9)10;1-2-4-6-5-3-1/h2-5H,1H3,(H,16,17);2-5H,1H3,(H2,9,10);1-6H2 |
| InChIKey | AHZKXQZPBGDZRV-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.97 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |