C17H20ClF3N4 — CID 163267179
4-[amino-[6-chloro-2-(trifluoromethyl)quinolin-4-yl]amino]-N-methylcyclohexan-1-amine (PubChem CID 163267179) has the molecular formula C17H20ClF3N4 and a molecular weight of 372.82 g/mol. Its IUPAC name is 4-[amino-[6-chloro-2-(trifluoromethyl)quinolin-4-yl]amino]-N-methylcyclohexan-1-amine.
| Compound Name | 4-[amino-[6-chloro-2-(trifluoromethyl)quinolin-4-yl]amino]-N-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 163267179 |
| Molecular Formula | C17H20ClF3N4 |
| Molecular Weight | 372.82 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 4-[amino-[6-chloro-2-(trifluoromethyl)quinolin-4-yl]amino]-N-methylcyclohexan-1-amine |
| SMILES | CNC1CCC(N(N)c2cc(C(F)(F)F)nc3ccc(Cl)cc23)CC1 |
| InChI | InChI=1S/C17H20ClF3N4/c1-23-11-3-5-12(6-4-11)25(22)15-9-16(17(19,20)21)24-14-7-2-10(18)8-13(14)15/h2,7-9,11-12,23H,3-6,22H2,1H3 |
| InChIKey | ZTFKVOPSOKZNAN-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.82 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|