C24H23ClF3N3O — CID 167099137
3-chloro-N-[4-[methyl-[2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]benzamide (PubChem CID 167099137) has the molecular formula C24H23ClF3N3O and a molecular weight of 461.92 g/mol. Its IUPAC name is 3-chloro-N-[4-[methyl-[2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]benzamide.
| Compound Name | 3-chloro-N-[4-[methyl-[2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]benzamide |
|---|---|
| PubChem CID | 167099137 |
| Molecular Formula | C24H23ClF3N3O |
| Molecular Weight | 461.92 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | 3-chloro-N-[4-[methyl-[2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]benzamide |
| SMILES | CN(c1cc(C(F)(F)F)nc2ccccc12)C1CCC(NC(=O)c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C24H23ClF3N3O/c1-31(21-14-22(24(26,27)28)30-20-8-3-2-7-19(20)21)18-11-9-17(10-12-18)29-23(32)15-5-4-6-16(25)13-15/h2-8,13-14,17-18H,9-12H2,1H3,(H,29,32) |
| InChIKey | YVLSKULFYLFUHY-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.92 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |