C29H32ClF3N4O3 — CID 167099287
benzyl N-[4-[[4-[[6-chloro-2-(trifluoromethyl)quinolin-4-yl]-methylamino]cyclohexyl]amino]-4-oxobutyl]carbamate (PubChem CID 167099287) has the molecular formula C29H32ClF3N4O3 and a molecular weight of 577.05 g/mol. Its IUPAC name is benzyl N-[4-[[4-[[6-chloro-2-(trifluoromethyl)quinolin-4-yl]-methylamino]cyclohexyl]amino]-4-oxobutyl]carbamate.
| Compound Name | benzyl N-[4-[[4-[[6-chloro-2-(trifluoromethyl)quinolin-4-yl]-methylamino]cyclohexyl]amino]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 167099287 |
| Molecular Formula | C29H32ClF3N4O3 |
| Molecular Weight | 577.05 g/mol |
| Exact Mass | 576.21 |
| IUPAC Name | benzyl N-[4-[[4-[[6-chloro-2-(trifluoromethyl)quinolin-4-yl]-methylamino]cyclohexyl]amino]-4-oxobutyl]carbamate |
| SMILES | CN(c1cc(C(F)(F)F)nc2ccc(Cl)cc12)C1CCC(NC(=O)CCCNC(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C29H32ClF3N4O3/c1-37(25-17-26(29(31,32)33)36-24-14-9-20(30)16-23(24)25)22-12-10-21(11-13-22)35-27(38)8-5-15-34-28(39)40-18-19-6-3-2-4-7-19/h2-4,6-7,9,14,16-17,21-22H,5,8,10-13,15,18H2,1H3,(H,34,39)(H,35,38) |
| InChIKey | JSMZIUHXVPECPC-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.05 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|