C23H21Cl2F3N4OS — CID 163267027
2-chloro-N-[4-[[6-chloro-2-(trifluoromethyl)quinolin-4-yl]-sulfanylamino]cyclohexyl]-4-methylpyridine-3-carboxamide (PubChem CID 163267027) has the molecular formula C23H21Cl2F3N4OS and a molecular weight of 529.42 g/mol. Its IUPAC name is 2-chloro-N-[4-[[6-chloro-2-(trifluoromethyl)quinolin-4-yl]-sulfanylamino]cyclohexyl]-4-methylpyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[4-[[6-chloro-2-(trifluoromethyl)quinolin-4-yl]-sulfanylamino]cyclohexyl]-4-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 163267027 |
| Molecular Formula | C23H21Cl2F3N4OS |
| Molecular Weight | 529.42 g/mol |
| Exact Mass | 528.08 |
| IUPAC Name | 2-chloro-N-[4-[[6-chloro-2-(trifluoromethyl)quinolin-4-yl]-sulfanylamino]cyclohexyl]-4-methylpyridine-3-carboxamide |
| SMILES | Cc1ccnc(Cl)c1C(=O)NC1CCC(N(S)c2cc(C(F)(F)F)nc3ccc(Cl)cc23)CC1 |
| InChI | InChI=1S/C23H21Cl2F3N4OS/c1-12-8-9-29-21(25)20(12)22(33)30-14-3-5-15(6-4-14)32(34)18-11-19(23(26,27)28)31-17-7-2-13(24)10-16(17)18/h2,7-11,14-15,34H,3-6H2,1H3,(H,30,33) |
| InChIKey | QJQZEBBJPGXSNC-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.42 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|