C21H26F3N3O — CID 167099516
2-methyl-N-[4-[methyl-[2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]propanamide (PubChem CID 167099516) has the molecular formula C21H26F3N3O and a molecular weight of 393.45 g/mol. Its IUPAC name is 2-methyl-N-[4-[methyl-[2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]propanamide.
| Compound Name | 2-methyl-N-[4-[methyl-[2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]propanamide |
|---|---|
| PubChem CID | 167099516 |
| Molecular Formula | C21H26F3N3O |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | 2-methyl-N-[4-[methyl-[2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]propanamide |
| SMILES | CC(C)C(=O)NC1CCC(N(C)c2cc(C(F)(F)F)nc3ccccc23)CC1 |
| InChI | InChI=1S/C21H26F3N3O/c1-13(2)20(28)25-14-8-10-15(11-9-14)27(3)18-12-19(21(22,23)24)26-17-7-5-4-6-16(17)18/h4-7,12-15H,8-11H2,1-3H3,(H,25,28) |
| InChIKey | MLKRBJCTEFFDGD-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |