methyl acetate;1-pyrrolidin-1-ylpent-4-en-1-one

C12H21NO3 — CID 169219029

IUPACmethyl acetate;1-pyrrolidin-1-ylpent-4-en-1-one
SMILESC=CCCC(=O)N1CCCC1.COC(C)=O
InChIInChI=1S/C9H15NO.C3H6O2/c1-2-3-6-9(11)10-7-4-5-8-10;1-3(4)5-2/h2H,1,3-8H2;1-2H3
InChIKeyXBXSZOOKYOCPQP-UHFFFAOYSA-N
MW227.30 g/mol
LogP1.75
Rot. Bonds3

About methyl acetate;1-pyrrolidin-1-ylpent-4-en-1-one

methyl acetate;1-pyrrolidin-1-ylpent-4-en-1-one (PubChem CID 169219029) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is methyl acetate;1-pyrrolidin-1-ylpent-4-en-1-one.

Molecular Properties

Compound Namemethyl acetate;1-pyrrolidin-1-ylpent-4-en-1-one
PubChem CID169219029
Molecular FormulaC12H21NO3
Molecular Weight227.30 g/mol
Exact Mass227.15
IUPAC Namemethyl acetate;1-pyrrolidin-1-ylpent-4-en-1-one
SMILESC=CCCC(=O)N1CCCC1.COC(C)=O
InChIInChI=1S/C9H15NO.C3H6O2/c1-2-3-6-9(11)10-7-4-5-8-10;1-3(4)5-2/h2H,1,3-8H2;1-2H3
InChIKeyXBXSZOOKYOCPQP-UHFFFAOYSA-N
XLogP1.75
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.30
LogP ≤ 51.75
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze methyl acetate;1-pyrrolidin-1-ylpent-4-en-1-one with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl acetate;1-pyrrolidin-1-ylpent-4-en-1-one?
The IUPAC name of methyl acetate;1-pyrrolidin-1-ylpent-4-en-1-one (CID 169219029) is methyl acetate;1-pyrrolidin-1-ylpent-4-en-1-one.
What is the SMILES notation for methyl acetate;1-pyrrolidin-1-ylpent-4-en-1-one?
The canonical SMILES for methyl acetate;1-pyrrolidin-1-ylpent-4-en-1-one is C=CCCC(=O)N1CCCC1.COC(C)=O.
What is the InChIKey of methyl acetate;1-pyrrolidin-1-ylpent-4-en-1-one?
The InChIKey is XBXSZOOKYOCPQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO.C3H6O2/c1-2-3-6-9(11)10-7-4-5-8-10;1-3(4)5-2/h2H,1,3-8H2;1-2H3.
What are the key properties of methyl acetate;1-pyrrolidin-1-ylpent-4-en-1-one?
methyl acetate;1-pyrrolidin-1-ylpent-4-en-1-one has a molecular weight of 227.30 g/mol, XLogP of 1.75, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl acetate;1-pyrrolidin-1-ylpent-4-en-1-one is sourced from PubChem (CID 169219029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).