C11H19NO3 — CID 142073193
3-pent-4-enoyl-1,3-oxazolidin-2-one;propane (PubChem CID 142073193) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 3-pent-4-enoyl-1,3-oxazolidin-2-one;propane.
| Compound Name | 3-pent-4-enoyl-1,3-oxazolidin-2-one;propane |
|---|---|
| PubChem CID | 142073193 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | 3-pent-4-enoyl-1,3-oxazolidin-2-one;propane |
| SMILES | C=CCCC(=O)N1CCOC1=O.CCC |
| InChI | InChI=1S/C8H11NO3.C3H8/c1-2-3-4-7(10)9-5-6-12-8(9)11;1-3-2/h2H,1,3-6H2;3H2,1-2H3 |
| InChIKey | FYRPYBRGKARQBE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|