About 4-azaspiro[2.4]heptane-7-carbonitrile;pyridine
4-azaspiro[2.4]heptane-7-carbonitrile;pyridine (PubChem CID 169219237) has the molecular formula C12H15N3
and a molecular weight of 201.27 g/mol. Its IUPAC name is 4-azaspiro[2.4]heptane-7-carbonitrile;pyridine.
Molecular Properties
| Compound Name | 4-azaspiro[2.4]heptane-7-carbonitrile;pyridine |
| PubChem CID | 169219237 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 4-azaspiro[2.4]heptane-7-carbonitrile;pyridine |
| SMILES | N#CC1CCNC12CC2.c1ccncc1 |
| InChI | InChI=1S/C7H10N2.C5H5N/c8-5-6-1-4-9-7(6)2-3-7;1-2-4-6-5-3-1/h6,9H,1-4H2;1-5H |
| InChIKey | IGPAKPOHAUXEKF-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-azaspiro[2.4]heptane-7-carbonitrile;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-azaspiro[2.4]heptane-7-carbonitrile;pyridine?
The IUPAC name of 4-azaspiro[2.4]heptane-7-carbonitrile;pyridine (CID 169219237) is 4-azaspiro[2.4]heptane-7-carbonitrile;pyridine.
What is the SMILES notation for 4-azaspiro[2.4]heptane-7-carbonitrile;pyridine?
The canonical SMILES for 4-azaspiro[2.4]heptane-7-carbonitrile;pyridine is N#CC1CCNC12CC2.c1ccncc1.
What is the InChIKey of 4-azaspiro[2.4]heptane-7-carbonitrile;pyridine?
The InChIKey is IGPAKPOHAUXEKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2.C5H5N/c8-5-6-1-4-9-7(6)2-3-7;1-2-4-6-5-3-1/h6,9H,1-4H2;1-5H.
What are the key properties of 4-azaspiro[2.4]heptane-7-carbonitrile;pyridine?
4-azaspiro[2.4]heptane-7-carbonitrile;pyridine has a molecular weight of 201.27 g/mol, XLogP of 1.73, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-azaspiro[2.4]heptane-7-carbonitrile;pyridine is sourced from PubChem (CID 169219237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).