About (4S)-4,5-dimethyl-1-pyrrolidin-1-ylhexan-1-one
(4S)-4,5-dimethyl-1-pyrrolidin-1-ylhexan-1-one (PubChem CID 169219250) has the molecular formula C12H23NO
and a molecular weight of 197.32 g/mol. Its IUPAC name is (4S)-4,5-dimethyl-1-pyrrolidin-1-ylhexan-1-one.
Molecular Properties
| Compound Name | (4S)-4,5-dimethyl-1-pyrrolidin-1-ylhexan-1-one |
| PubChem CID | 169219250 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | (4S)-4,5-dimethyl-1-pyrrolidin-1-ylhexan-1-one |
| SMILES | CC(C)[C@@H](C)CCC(=O)N1CCCC1 |
| InChI | InChI=1S/C12H23NO/c1-10(2)11(3)6-7-12(14)13-8-4-5-9-13/h10-11H,4-9H2,1-3H3/t11-/m0/s1 |
| InChIKey | MAZKGTWVLIJRQS-NSHDSACASA-N |
| XLogP | 2.68 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4S)-4,5-dimethyl-1-pyrrolidin-1-ylhexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4,5-dimethyl-1-pyrrolidin-1-ylhexan-1-one?
The IUPAC name of (4S)-4,5-dimethyl-1-pyrrolidin-1-ylhexan-1-one (CID 169219250) is (4S)-4,5-dimethyl-1-pyrrolidin-1-ylhexan-1-one.
What is the SMILES notation for (4S)-4,5-dimethyl-1-pyrrolidin-1-ylhexan-1-one?
The canonical SMILES for (4S)-4,5-dimethyl-1-pyrrolidin-1-ylhexan-1-one is CC(C)[C@@H](C)CCC(=O)N1CCCC1.
What is the InChIKey of (4S)-4,5-dimethyl-1-pyrrolidin-1-ylhexan-1-one?
The InChIKey is MAZKGTWVLIJRQS-NSHDSACASA-N. The full InChI is InChI=1S/C12H23NO/c1-10(2)11(3)6-7-12(14)13-8-4-5-9-13/h10-11H,4-9H2,1-3H3/t11-/m0/s1.
What are the key properties of (4S)-4,5-dimethyl-1-pyrrolidin-1-ylhexan-1-one?
(4S)-4,5-dimethyl-1-pyrrolidin-1-ylhexan-1-one has a molecular weight of 197.32 g/mol, XLogP of 2.68, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4,5-dimethyl-1-pyrrolidin-1-ylhexan-1-one is sourced from PubChem (CID 169219250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).