C12H23NO — CID 169219250
(4S)-4,5-dimethyl-1-pyrrolidin-1-ylhexan-1-one (PubChem CID 169219250) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is (4S)-4,5-dimethyl-1-pyrrolidin-1-ylhexan-1-one.
| Compound Name | (4S)-4,5-dimethyl-1-pyrrolidin-1-ylhexan-1-one |
|---|---|
| PubChem CID | 169219250 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | (4S)-4,5-dimethyl-1-pyrrolidin-1-ylhexan-1-one |
| SMILES | CC(C)[C@@H](C)CCC(=O)N1CCCC1 |
| InChI | InChI=1S/C12H23NO/c1-10(2)11(3)6-7-12(14)13-8-4-5-9-13/h10-11H,4-9H2,1-3H3/t11-/m0/s1 |
| InChIKey | MAZKGTWVLIJRQS-NSHDSACASA-N |
| XLogP | 2.68 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |