C19H15FN4O2 — CID 169220235
6-[2-(2-fluoro-5-formylbenzoyl)-2,6-diazaspiro[3.3]heptan-6-yl]pyridine-3-carbonitrile (PubChem CID 169220235) has the molecular formula C19H15FN4O2 and a molecular weight of 350.35 g/mol. Its IUPAC name is 6-[2-(2-fluoro-5-formylbenzoyl)-2,6-diazaspiro[3.3]heptan-6-yl]pyridine-3-carbonitrile.
| Compound Name | 6-[2-(2-fluoro-5-formylbenzoyl)-2,6-diazaspiro[3.3]heptan-6-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 169220235 |
| Molecular Formula | C19H15FN4O2 |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 6-[2-(2-fluoro-5-formylbenzoyl)-2,6-diazaspiro[3.3]heptan-6-yl]pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(N2CC3(CN(C(=O)c4cc(C=O)ccc4F)C3)C2)nc1 |
| InChI | InChI=1S/C19H15FN4O2/c20-16-3-1-13(8-25)5-15(16)18(26)24-11-19(12-24)9-23(10-19)17-4-2-14(6-21)7-22-17/h1-5,7-8H,9-12H2 |
| InChIKey | DXYGEZQUAHINPA-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 77.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|