C18H26N4O2 — CID 169220277
6-(2-tert-butyl-2,7-diazaspiro[4.4]nonan-7-yl)pyridine-3-carbonitrile;formic acid (PubChem CID 169220277) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is 6-(2-tert-butyl-2,7-diazaspiro[4.4]nonan-7-yl)pyridine-3-carbonitrile;formic acid.
| Compound Name | 6-(2-tert-butyl-2,7-diazaspiro[4.4]nonan-7-yl)pyridine-3-carbonitrile;formic acid |
|---|---|
| PubChem CID | 169220277 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | 6-(2-tert-butyl-2,7-diazaspiro[4.4]nonan-7-yl)pyridine-3-carbonitrile;formic acid |
| SMILES | CC(C)(C)N1CCC2(CCN(c3ccc(C#N)cn3)C2)C1.O=CO |
| InChI | InChI=1S/C17H24N4.CH2O2/c1-16(2,3)21-9-7-17(13-21)6-8-20(12-17)15-5-4-14(10-18)11-19-15;2-1-3/h4-5,11H,6-9,12-13H2,1-3H3;1H,(H,2,3) |
| InChIKey | RRLXMKOKXSQENL-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 80.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|