2-[[2,6-dichloro-4-(diethylamino)benzoyl]amino]propanoic acid

C14H18Cl2N2O3 — CID 169223700

IUPAC2-[[2,6-dichloro-4-(diethylamino)benzoyl]amino]propanoic acid
SMILESCCN(CC)c1cc(Cl)c(C(=O)NC(C)C(=O)O)c(Cl)c1
InChIInChI=1S/C14H18Cl2N2O3/c1-4-18(5-2)9-6-10(15)12(11(16)7-9)13(19)17-8(3)14(20)21/h6-8H,4-5H2,1-3H3,(H,17,19)(H,20,21)
InChIKeySVDNBTASPYQADC-UHFFFAOYSA-N
MW333.22 g/mol
LogP3.04
Rot. Bonds6

About 2-[[2,6-dichloro-4-(diethylamino)benzoyl]amino]propanoic acid

2-[[2,6-dichloro-4-(diethylamino)benzoyl]amino]propanoic acid (PubChem CID 169223700) has the molecular formula C14H18Cl2N2O3 and a molecular weight of 333.22 g/mol. Its IUPAC name is 2-[[2,6-dichloro-4-(diethylamino)benzoyl]amino]propanoic acid.

Molecular Properties

Compound Name2-[[2,6-dichloro-4-(diethylamino)benzoyl]amino]propanoic acid
PubChem CID169223700
Molecular FormulaC14H18Cl2N2O3
Molecular Weight333.22 g/mol
Exact Mass332.07
IUPAC Name2-[[2,6-dichloro-4-(diethylamino)benzoyl]amino]propanoic acid
SMILESCCN(CC)c1cc(Cl)c(C(=O)NC(C)C(=O)O)c(Cl)c1
InChIInChI=1S/C14H18Cl2N2O3/c1-4-18(5-2)9-6-10(15)12(11(16)7-9)13(19)17-8(3)14(20)21/h6-8H,4-5H2,1-3H3,(H,17,19)(H,20,21)
InChIKeySVDNBTASPYQADC-UHFFFAOYSA-N
XLogP3.04
TPSA69.64 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500333.22
LogP ≤ 53.04
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-[[2,6-dichloro-4-(diethylamino)benzoyl]amino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[[2,6-dichloro-4-(diethylamino)benzoyl]amino]propanoic acid?
The IUPAC name of 2-[[2,6-dichloro-4-(diethylamino)benzoyl]amino]propanoic acid (CID 169223700) is 2-[[2,6-dichloro-4-(diethylamino)benzoyl]amino]propanoic acid.
What is the SMILES notation for 2-[[2,6-dichloro-4-(diethylamino)benzoyl]amino]propanoic acid?
The canonical SMILES for 2-[[2,6-dichloro-4-(diethylamino)benzoyl]amino]propanoic acid is CCN(CC)c1cc(Cl)c(C(=O)NC(C)C(=O)O)c(Cl)c1.
What is the InChIKey of 2-[[2,6-dichloro-4-(diethylamino)benzoyl]amino]propanoic acid?
The InChIKey is SVDNBTASPYQADC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18Cl2N2O3/c1-4-18(5-2)9-6-10(15)12(11(16)7-9)13(19)17-8(3)14(20)21/h6-8H,4-5H2,1-3H3,(H,17,19)(H,20,21).
What are the key properties of 2-[[2,6-dichloro-4-(diethylamino)benzoyl]amino]propanoic acid?
2-[[2,6-dichloro-4-(diethylamino)benzoyl]amino]propanoic acid has a molecular weight of 333.22 g/mol, XLogP of 3.04, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2,6-dichloro-4-(diethylamino)benzoyl]amino]propanoic acid is sourced from PubChem (CID 169223700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).