C8H8ClNO3S — CID 110836827
(2S)-2-[(4-chlorothiophene-2-carbonyl)amino]propanoic acid (PubChem CID 110836827) has the molecular formula C8H8ClNO3S and a molecular weight of 233.68 g/mol. Its IUPAC name is (2S)-2-[(4-chlorothiophene-2-carbonyl)amino]propanoic acid.
| Compound Name | (2S)-2-[(4-chlorothiophene-2-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 110836827 |
| Molecular Formula | C8H8ClNO3S |
| Molecular Weight | 233.68 g/mol |
| Exact Mass | 232.99 |
| IUPAC Name | (2S)-2-[(4-chlorothiophene-2-carbonyl)amino]propanoic acid |
| SMILES | C[C@H](NC(=O)c1cc(Cl)cs1)C(=O)O |
| InChI | InChI=1S/C8H8ClNO3S/c1-4(8(12)13)10-7(11)6-2-5(9)3-14-6/h2-4H,1H3,(H,10,11)(H,12,13)/t4-/m0/s1 |
| InChIKey | HCQMPUDSCSBJSG-BYPYZUCNSA-N |
| XLogP | 1.60 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.68 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |