C18H13Cl2F4N3OS — CID 169227816
1-[4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-fluorophenyl]-3-methylthiourea (PubChem CID 169227816) has the molecular formula C18H13Cl2F4N3OS and a molecular weight of 466.29 g/mol. Its IUPAC name is 1-[4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-fluorophenyl]-3-methylthiourea.
| Compound Name | 1-[4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-fluorophenyl]-3-methylthiourea |
|---|---|
| PubChem CID | 169227816 |
| Molecular Formula | C18H13Cl2F4N3OS |
| Molecular Weight | 466.29 g/mol |
| Exact Mass | 465.01 |
| IUPAC Name | 1-[4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-fluorophenyl]-3-methylthiourea |
| SMILES | CNC(=S)Nc1ccc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)cc1F |
| InChI | InChI=1S/C18H13Cl2F4N3OS/c1-25-16(29)26-14-3-2-9(4-13(14)21)15-8-17(28-27-15,18(22,23)24)10-5-11(19)7-12(20)6-10/h2-7H,8H2,1H3,(H2,25,26,29) |
| InChIKey | ITWLDAWDMAUGIC-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.29 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|