C13H29N3 — CID 169227867
N-(3-aminopropyl)-1-cyclohexyl-N'-methylpropane-1,3-diamine (PubChem CID 169227867) has the molecular formula C13H29N3 and a molecular weight of 227.40 g/mol. Its IUPAC name is N-(3-aminopropyl)-1-cyclohexyl-N'-methylpropane-1,3-diamine.
| Compound Name | N-(3-aminopropyl)-1-cyclohexyl-N'-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 169227867 |
| Molecular Formula | C13H29N3 |
| Molecular Weight | 227.40 g/mol |
| Exact Mass | 227.24 |
| IUPAC Name | N-(3-aminopropyl)-1-cyclohexyl-N'-methylpropane-1,3-diamine |
| SMILES | CNCCC(NCCCN)C1CCCCC1 |
| InChI | InChI=1S/C13H29N3/c1-15-11-8-13(16-10-5-9-14)12-6-3-2-4-7-12/h12-13,15-16H,2-11,14H2,1H3 |
| InChIKey | LTVYKQOOOPABRQ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.40 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|