C19H38N2 — CID 21396646
N'-(1,5-dicyclohexylpentyl)ethane-1,2-diamine (PubChem CID 21396646) has the molecular formula C19H38N2 and a molecular weight of 294.53 g/mol. Its IUPAC name is N'-(1,5-dicyclohexylpentyl)ethane-1,2-diamine.
| Compound Name | N'-(1,5-dicyclohexylpentyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 21396646 |
| Molecular Formula | C19H38N2 |
| Molecular Weight | 294.53 g/mol |
| Exact Mass | 294.30 |
| IUPAC Name | N'-(1,5-dicyclohexylpentyl)ethane-1,2-diamine |
| SMILES | NCCNC(CCCCC1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C19H38N2/c20-15-16-21-19(18-12-5-2-6-13-18)14-8-7-11-17-9-3-1-4-10-17/h17-19,21H,1-16,20H2 |
| InChIKey | GKPONCJYKVSSKC-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.53 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|