6-(1,4-diazepan-1-ylmethyl)-1-benzothiophene-2-carboxylic acid

C15H18N2O2S — CID 169229612

IUPAC6-(1,4-diazepan-1-ylmethyl)-1-benzothiophene-2-carboxylic acid
SMILESO=C(O)c1cc2ccc(CN3CCCNCC3)cc2s1
InChIInChI=1S/C15H18N2O2S/c18-15(19)14-9-12-3-2-11(8-13(12)20-14)10-17-6-1-4-16-5-7-17/h2-3,8-9,16H,1,4-7,10H2,(H,18,19)
InChIKeyGGXLVEBIGJPBBN-UHFFFAOYSA-N
MW290.39 g/mol
LogP2.39
Rot. Bonds3

About 6-(1,4-diazepan-1-ylmethyl)-1-benzothiophene-2-carboxylic acid

6-(1,4-diazepan-1-ylmethyl)-1-benzothiophene-2-carboxylic acid (PubChem CID 169229612) has the molecular formula C15H18N2O2S and a molecular weight of 290.39 g/mol. Its IUPAC name is 6-(1,4-diazepan-1-ylmethyl)-1-benzothiophene-2-carboxylic acid.

Molecular Properties

Compound Name6-(1,4-diazepan-1-ylmethyl)-1-benzothiophene-2-carboxylic acid
PubChem CID169229612
Molecular FormulaC15H18N2O2S
Molecular Weight290.39 g/mol
Exact Mass290.11
IUPAC Name6-(1,4-diazepan-1-ylmethyl)-1-benzothiophene-2-carboxylic acid
SMILESO=C(O)c1cc2ccc(CN3CCCNCC3)cc2s1
InChIInChI=1S/C15H18N2O2S/c18-15(19)14-9-12-3-2-11(8-13(12)20-14)10-17-6-1-4-16-5-7-17/h2-3,8-9,16H,1,4-7,10H2,(H,18,19)
InChIKeyGGXLVEBIGJPBBN-UHFFFAOYSA-N
XLogP2.39
TPSA52.57 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500290.39
LogP ≤ 52.39
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 6-(1,4-diazepan-1-ylmethyl)-1-benzothiophene-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-(1,4-diazepan-1-ylmethyl)-1-benzothiophene-2-carboxylic acid?
The IUPAC name of 6-(1,4-diazepan-1-ylmethyl)-1-benzothiophene-2-carboxylic acid (CID 169229612) is 6-(1,4-diazepan-1-ylmethyl)-1-benzothiophene-2-carboxylic acid.
What is the SMILES notation for 6-(1,4-diazepan-1-ylmethyl)-1-benzothiophene-2-carboxylic acid?
The canonical SMILES for 6-(1,4-diazepan-1-ylmethyl)-1-benzothiophene-2-carboxylic acid is O=C(O)c1cc2ccc(CN3CCCNCC3)cc2s1.
What is the InChIKey of 6-(1,4-diazepan-1-ylmethyl)-1-benzothiophene-2-carboxylic acid?
The InChIKey is GGXLVEBIGJPBBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O2S/c18-15(19)14-9-12-3-2-11(8-13(12)20-14)10-17-6-1-4-16-5-7-17/h2-3,8-9,16H,1,4-7,10H2,(H,18,19).
What are the key properties of 6-(1,4-diazepan-1-ylmethyl)-1-benzothiophene-2-carboxylic acid?
6-(1,4-diazepan-1-ylmethyl)-1-benzothiophene-2-carboxylic acid has a molecular weight of 290.39 g/mol, XLogP of 2.39, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1,4-diazepan-1-ylmethyl)-1-benzothiophene-2-carboxylic acid is sourced from PubChem (CID 169229612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).