C15H18N2O2S — CID 169229612
6-(1,4-diazepan-1-ylmethyl)-1-benzothiophene-2-carboxylic acid (PubChem CID 169229612) has the molecular formula C15H18N2O2S and a molecular weight of 290.39 g/mol. Its IUPAC name is 6-(1,4-diazepan-1-ylmethyl)-1-benzothiophene-2-carboxylic acid.
| Compound Name | 6-(1,4-diazepan-1-ylmethyl)-1-benzothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 169229612 |
| Molecular Formula | C15H18N2O2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 6-(1,4-diazepan-1-ylmethyl)-1-benzothiophene-2-carboxylic acid |
| SMILES | O=C(O)c1cc2ccc(CN3CCCNCC3)cc2s1 |
| InChI | InChI=1S/C15H18N2O2S/c18-15(19)14-9-12-3-2-11(8-13(12)20-14)10-17-6-1-4-16-5-7-17/h2-3,8-9,16H,1,4-7,10H2,(H,18,19) |
| InChIKey | GGXLVEBIGJPBBN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |