C30H28N2O6S — CID 169229678
N-[4-methyl-3-[[6-(2-prop-2-enoxyethoxy)-1-benzothiophene-2-carbonyl]amino]phenyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide (PubChem CID 169229678) has the molecular formula C30H28N2O6S and a molecular weight of 544.63 g/mol. Its IUPAC name is N-[4-methyl-3-[[6-(2-prop-2-enoxyethoxy)-1-benzothiophene-2-carbonyl]amino]phenyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide.
| Compound Name | N-[4-methyl-3-[[6-(2-prop-2-enoxyethoxy)-1-benzothiophene-2-carbonyl]amino]phenyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
|---|---|
| PubChem CID | 169229678 |
| Molecular Formula | C30H28N2O6S |
| Molecular Weight | 544.63 g/mol |
| Exact Mass | 544.17 |
| IUPAC Name | N-[4-methyl-3-[[6-(2-prop-2-enoxyethoxy)-1-benzothiophene-2-carbonyl]amino]phenyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
| SMILES | C=CCOCCOc1ccc2cc(C(=O)Nc3cc(NC(=O)c4ccc5c(c4)OCCO5)ccc3C)sc2c1 |
| InChI | InChI=1S/C30H28N2O6S/c1-3-10-35-11-12-36-23-8-5-20-16-28(39-27(20)18-23)30(34)32-24-17-22(7-4-19(24)2)31-29(33)21-6-9-25-26(15-21)38-14-13-37-25/h3-9,15-18H,1,10-14H2,2H3,(H,31,33)(H,32,34) |
| InChIKey | NSLLMXBRADFVPE-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.63 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|