C24H17BFN3O4S — CID 169229549
CID 169229549 (PubChem CID 169229549) has the molecular formula C24H17BFN3O4S and a molecular weight of 473.29 g/mol.
| Compound Name | CID 169229549 |
|---|---|
| PubChem CID | 169229549 |
| Molecular Formula | C24H17BFN3O4S |
| Molecular Weight | 473.29 g/mol |
| Exact Mass | 473.10 |
| IUPAC Name | — |
| SMILES | [B]Cc1ccc2cc(C(=O)Nc3cc(NC(=O)c4ccc5c(c4)OCCO5)ccc3F)sc2n1 |
| InChI | InChI=1S/C24H17BFN3O4S/c25-12-16-3-1-14-10-21(34-24(14)28-16)23(31)29-18-11-15(4-5-17(18)26)27-22(30)13-2-6-19-20(9-13)33-8-7-32-19/h1-6,9-11H,7-8,12H2,(H,27,30)(H,29,31) |
| InChIKey | ARDUWJIRGUDSIS-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.29 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|