C32H32FN5O9 — CID 134413562
N-[5-(2,3-dihydro-1,4-benzodioxine-6-carbonylamino)-2-fluorophenyl]-2-[[4-(1,1,2,2,2-pentahydroxyethyl)piperazin-1-yl]methyl]quinoline-6-carboxamide (PubChem CID 134413562) has the molecular formula C32H32FN5O9 and a molecular weight of 649.63 g/mol. Its IUPAC name is N-[5-(2,3-dihydro-1,4-benzodioxine-6-carbonylamino)-2-fluorophenyl]-2-[[4-(1,1,2,2,2-pentahydroxyethyl)piperazin-1-yl]methyl]quinoline-6-carboxamide.
| Compound Name | N-[5-(2,3-dihydro-1,4-benzodioxine-6-carbonylamino)-2-fluorophenyl]-2-[[4-(1,1,2,2,2-pentahydroxyethyl)piperazin-1-yl]methyl]quinoline-6-carboxamide |
|---|---|
| PubChem CID | 134413562 |
| Molecular Formula | C32H32FN5O9 |
| Molecular Weight | 649.63 g/mol |
| Exact Mass | 649.22 |
| IUPAC Name | N-[5-(2,3-dihydro-1,4-benzodioxine-6-carbonylamino)-2-fluorophenyl]-2-[[4-(1,1,2,2,2-pentahydroxyethyl)piperazin-1-yl]methyl]quinoline-6-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(NC(=O)c2ccc3nc(CN4CCN(C(O)(O)C(O)(O)O)CC4)ccc3c2)c1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C32H32FN5O9/c33-24-6-5-22(35-29(39)21-3-8-27-28(16-21)47-14-13-46-27)17-26(24)36-30(40)20-2-7-25-19(15-20)1-4-23(34-25)18-37-9-11-38(12-10-37)31(41,42)32(43,44)45/h1-8,15-17,41-45H,9-14,18H2,(H,35,39)(H,36,40) |
| InChIKey | XJFROVCTZIVAAW-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 197.18 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.63 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|