C27H19FN2O5 — CID 159549515
N-[5-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl]-2-fluorophenyl]-2-formylquinoline-6-carboxamide (PubChem CID 159549515) has the molecular formula C27H19FN2O5 and a molecular weight of 470.46 g/mol. Its IUPAC name is N-[5-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl]-2-fluorophenyl]-2-formylquinoline-6-carboxamide.
| Compound Name | N-[5-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl]-2-fluorophenyl]-2-formylquinoline-6-carboxamide |
|---|---|
| PubChem CID | 159549515 |
| Molecular Formula | C27H19FN2O5 |
| Molecular Weight | 470.46 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | N-[5-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl]-2-fluorophenyl]-2-formylquinoline-6-carboxamide |
| SMILES | O=Cc1ccc2cc(C(=O)Nc3cc(CC(=O)c4ccc5c(c4)OCCO5)ccc3F)ccc2n1 |
| InChI | InChI=1S/C27H19FN2O5/c28-21-6-1-16(12-24(32)18-4-8-25-26(14-18)35-10-9-34-25)11-23(21)30-27(33)19-3-7-22-17(13-19)2-5-20(15-31)29-22/h1-8,11,13-15H,9-10,12H2,(H,30,33) |
| InChIKey | MFFFRGJZFRQPCF-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.46 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|