C33H29ClN4O — CID 22340315
4-(4-chlorophenyl)-N-[2-[(4-phenylpiperazin-1-yl)methyl]quinolin-6-yl]benzamide (PubChem CID 22340315) has the molecular formula C33H29ClN4O and a molecular weight of 533.08 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-[2-[(4-phenylpiperazin-1-yl)methyl]quinolin-6-yl]benzamide.
| Compound Name | 4-(4-chlorophenyl)-N-[2-[(4-phenylpiperazin-1-yl)methyl]quinolin-6-yl]benzamide |
|---|---|
| PubChem CID | 22340315 |
| Molecular Formula | C33H29ClN4O |
| Molecular Weight | 533.08 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | 4-(4-chlorophenyl)-N-[2-[(4-phenylpiperazin-1-yl)methyl]quinolin-6-yl]benzamide |
| SMILES | O=C(Nc1ccc2nc(CN3CCN(c4ccccc4)CC3)ccc2c1)c1ccc(-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C33H29ClN4O/c34-28-13-10-25(11-14-28)24-6-8-26(9-7-24)33(39)36-29-16-17-32-27(22-29)12-15-30(35-32)23-37-18-20-38(21-19-37)31-4-2-1-3-5-31/h1-17,22H,18-21,23H2,(H,36,39) |
| InChIKey | YTYXFLCKASRSOS-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.08 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |