C30H24ClN3O — CID 20823335
4-(4-chlorophenyl)-N-[2-[(N-methylanilino)methyl]quinolin-6-yl]benzamide (PubChem CID 20823335) has the molecular formula C30H24ClN3O and a molecular weight of 478.00 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-[2-[(N-methylanilino)methyl]quinolin-6-yl]benzamide.
| Compound Name | 4-(4-chlorophenyl)-N-[2-[(N-methylanilino)methyl]quinolin-6-yl]benzamide |
|---|---|
| PubChem CID | 20823335 |
| Molecular Formula | C30H24ClN3O |
| Molecular Weight | 478.00 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | 4-(4-chlorophenyl)-N-[2-[(N-methylanilino)methyl]quinolin-6-yl]benzamide |
| SMILES | CN(Cc1ccc2cc(NC(=O)c3ccc(-c4ccc(Cl)cc4)cc3)ccc2n1)c1ccccc1 |
| InChI | InChI=1S/C30H24ClN3O/c1-34(28-5-3-2-4-6-28)20-27-16-13-24-19-26(17-18-29(24)32-27)33-30(35)23-9-7-21(8-10-23)22-11-14-25(31)15-12-22/h2-19H,20H2,1H3,(H,33,35) |
| InChIKey | HFQGWVGGEABKBO-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.00 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |