C26H22ClN3OS — CID 22340496
4-(4-chlorophenyl)-N-[2-(1,3-thiazolidin-3-ylmethyl)quinolin-6-yl]benzamide (PubChem CID 22340496) has the molecular formula C26H22ClN3OS and a molecular weight of 460.00 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-[2-(1,3-thiazolidin-3-ylmethyl)quinolin-6-yl]benzamide.
| Compound Name | 4-(4-chlorophenyl)-N-[2-(1,3-thiazolidin-3-ylmethyl)quinolin-6-yl]benzamide |
|---|---|
| PubChem CID | 22340496 |
| Molecular Formula | C26H22ClN3OS |
| Molecular Weight | 460.00 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | 4-(4-chlorophenyl)-N-[2-(1,3-thiazolidin-3-ylmethyl)quinolin-6-yl]benzamide |
| SMILES | O=C(Nc1ccc2nc(CN3CCSC3)ccc2c1)c1ccc(-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C26H22ClN3OS/c27-22-8-5-19(6-9-22)18-1-3-20(4-2-18)26(31)29-23-11-12-25-21(15-23)7-10-24(28-25)16-30-13-14-32-17-30/h1-12,15H,13-14,16-17H2,(H,29,31) |
| InChIKey | PKPFAQVIGSNQCH-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.00 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |